Products 201655-95-0
CAS 201655-95-0 is the registry number for 3-Hydroxy-2,3-dihydro-1H-indene-1-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-hydroxy-2,3-dihydro-1H-indene-1-carboxylic acid (CAS 201655-95-0) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3-hydroxy-2,3-dihydro-1H-indene-1-carboxylic acid. InChIKey: XAZCDGLACKFUCI-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3-hydroxy-2,3-dihydro-1H-indene-1-carboxylic acid |
| InChIKey | XAZCDGLACKFUCI-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2C1O)C(=O)O |
Computed by PubChem (NCBI)