CAS 201668-33-9 appears in our catalog under these names: 2-((2-((4-Fluorophenyl)(1-methylethyl)amino)-2-oxoethyl)sulfinyl)acetic Acid, Flufenacet-thioglycolate sulfoxide, Flufenacet Metabolite FOE5043, Concentration: 100 µg/ml Solvent: Acetonitrile, Flufenacet Metabolite FOE5043. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 250mg, 10mg, 1x1ml, 1x10mg.
2-[2-(4-fluoro-N-propan-2-ylanilino)-2-oxoethyl]sulfinylacetic acid (CAS 201668-33-9) is a chemical compound with the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. IUPAC name: 2-[2-(4-fluoro-N-propan-2-ylanilino)-2-oxoethyl]sulfinylacetic acid. InChIKey: JCMMUCVPUOXQDO-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO4S |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 2-[2-(4-fluoro-N-propan-2-ylanilino)-2-oxoethyl]sulfinylacetic acid |
| InChIKey | JCMMUCVPUOXQDO-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC=C(C=C1)F)C(=O)CS(=O)CC(=O)O |
Computed by PubChem (NCBI)