CAS 914637-67-5 is the registry number for 1-[2-Fluoro-4-(methylsulfonyl)phenyl]piperidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1-(2-fluoro-4-methylsulfonylphenyl)piperidine-3-carboxylic acid (CAS 914637-67-5) is a chemical compound with the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. IUPAC name: 1-(2-fluoro-4-methylsulfonylphenyl)piperidine-3-carboxylic acid. InChIKey: LQDSRWORXHXPED-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO4S |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 1-(2-fluoro-4-methylsulfonylphenyl)piperidine-3-carboxylic acid |
| InChIKey | LQDSRWORXHXPED-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)N2CCCC(C2)C(=O)O)F |
Computed by PubChem (NCBI)