Products 914637-69-7

CAS 914637-69-7 is the registry number for 1-[2-Fluoro-4-(methylsulphonyl)phenyl]piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-(2-fluoro-4-methylsulfonylphenyl)piperidine-4-carboxylic acid (CAS 914637-69-7) is a chemical compound with the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. IUPAC name: 1-(2-fluoro-4-methylsulfonylphenyl)piperidine-4-carboxylic acid. InChIKey: SGLKZCURYDEFJN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16FNO4S
Molecular weight301.34 g/mol
IUPAC name1-(2-fluoro-4-methylsulfonylphenyl)piperidine-4-carboxylic acid
InChIKeySGLKZCURYDEFJN-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC(=C(C=C1)N2CCC(CC2)C(=O)O)F

Computed by PubChem (NCBI)