CAS 201847-53-2 is the registry number for H–β–Ala–AMC · TFA. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
3-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid (CAS 201847-53-2) is a chemical compound with the molecular formula C15H15F3N2O5 and a molecular weight of 360.28 g/mol. IUPAC name: 3-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid. InChIKey: BFXHWJNREYBZJN-UHFFFAOYSA-N.
| Molecular formula | C15H15F3N2O5 |
|---|---|
| Molecular weight | 360.28 g/mol |
| IUPAC name | 3-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid |
| InChIKey | BFXHWJNREYBZJN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)CCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)