Products 20201-28-9

CAS 20201-28-9 is the registry number for 2-Phenylpropane-1,1,1,2,3,3,3-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1,1,1,2,3,3,3-heptadeuteriopropan-2-ylbenzene (CAS 20201-28-9) is a chemical compound with the molecular formula C9H12 and a molecular weight of 127.23 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuteriopropan-2-ylbenzene. InChIKey: RWGFKTVRMDUZSP-UNAVHCQLSA-N.

Identity
Molecular formulaC9H12
Molecular weight127.23 g/mol
IUPAC name1,1,1,2,3,3,3-heptadeuteriopropan-2-ylbenzene
InChIKeyRWGFKTVRMDUZSP-UNAVHCQLSA-N
SMILES[2H]C([2H])([2H])C([2H])(C1=CC=CC=C1)C([2H])([2H])[2H]

Computed by PubChem (NCBI)