Products 97732-82-6
CAS 97732-82-6 appears in our catalog under these names: 2-Phenylpropane-d12, 98 atom % D, min 98% Chemical Purity, Cumene-D12 99 atom % D. Offered by: CDN, Deutero. Available pack sizes: 0,5g, 0,25g, 0,7ml, 5ml.
1,2,3,4,5-pentadeuterio-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene (CAS 97732-82-6) is a chemical compound with the molecular formula C9H12 and a molecular weight of 132.26 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene. InChIKey: RWGFKTVRMDUZSP-CLWNCLMISA-N.
| Molecular formula | C9H12 |
|---|---|
| Molecular weight | 132.26 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)benzene |
| InChIKey | RWGFKTVRMDUZSP-CLWNCLMISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)