Products 20201-29-0

CAS 20201-29-0 is the registry number for 2-Phenylpropane-1,1,1,3,3,3-d6, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1,1,1,3,3,3-hexadeuteriopropan-2-ylbenzene (CAS 20201-29-0) is a chemical compound with the molecular formula C9H12 and a molecular weight of 126.23 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuteriopropan-2-ylbenzene. InChIKey: RWGFKTVRMDUZSP-WFGJKAKNSA-N.

Identity
Molecular formulaC9H12
Molecular weight126.23 g/mol
IUPAC name1,1,1,3,3,3-hexadeuteriopropan-2-ylbenzene
InChIKeyRWGFKTVRMDUZSP-WFGJKAKNSA-N
SMILES[2H]C([2H])([2H])C(C1=CC=CC=C1)C([2H])([2H])[2H]

Computed by PubChem (NCBI)