CAS 20201-29-0 is the registry number for 2-Phenylpropane-1,1,1,3,3,3-d6, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,1,1,3,3,3-hexadeuteriopropan-2-ylbenzene (CAS 20201-29-0) is a chemical compound with the molecular formula C9H12 and a molecular weight of 126.23 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuteriopropan-2-ylbenzene. InChIKey: RWGFKTVRMDUZSP-WFGJKAKNSA-N.
| Molecular formula | C9H12 |
|---|---|
| Molecular weight | 126.23 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexadeuteriopropan-2-ylbenzene |
| InChIKey | RWGFKTVRMDUZSP-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=CC=C1)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)