CAS 20216-93-7 appears in our catalog under these names: n-Nonylbenzene-2,3,4,5,6-d5, 98 atom % D, min 98% Chemical Purity, n-Nonylbenzene-2,3,4,5,6-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1,2,3,4,5-pentadeuterio-6-nonylbenzene (CAS 20216-93-7) is a chemical compound with the molecular formula C15H24 and a molecular weight of 209.38 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-nonylbenzene. InChIKey: LIXVMPBOGDCSRM-VDUBJQOGSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 209.38 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-nonylbenzene |
| InChIKey | LIXVMPBOGDCSRM-VDUBJQOGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CCCCCCCCC)[2H])[2H] |
Computed by PubChem (NCBI)