Products 2022152-96-9
CAS 2022152-96-9 appears in our catalog under these names: Methyl trans-Cinnamate-d7, 98 atom % D, min 98% Chemical Purity, Methyl(E)-cinnamate-d7, 99.1%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 50 mg, 25 mg, 10 mg.
Methyl (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate (CAS 2022152-96-9) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 169.23 g/mol. IUPAC name: methyl (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate. InChIKey: CCRCUPLGCSFEDV-RTRAALMGSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 169.23 g/mol |
| IUPAC name | methyl (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate |
| InChIKey | CCRCUPLGCSFEDV-RTRAALMGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C(=C(\[2H])/C(=O)OC)/[2H])[2H])[2H] |
Computed by PubChem (NCBI)