Products 61764-82-7
CAS 61764-82-7 appears in our catalog under these names: Methyl trans-Cinnamate-d5 (phenyl-d5), 98 atom % D, min 98% Chemical Purity, Methyl (E)-cinnamate-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
Methyl (E)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate (CAS 61764-82-7) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 167.22 g/mol. IUPAC name: methyl (E)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate. InChIKey: CCRCUPLGCSFEDV-XLKVIOBLSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 167.22 g/mol |
| IUPAC name | methyl (E)-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoate |
| InChIKey | CCRCUPLGCSFEDV-XLKVIOBLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C=C/C(=O)OC)[2H])[2H] |
Computed by PubChem (NCBI)