Products 2022163-86-4
CAS 2022163-86-4 is the registry number for 2',5'-Di-tert-butyl-4,4''-dihydroxy-[1,1':4',1''-terphenyl]-3,3''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2,5-ditert-butyl-4-(3-carboxy-4-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid (CAS 2022163-86-4) is a chemical compound with the molecular formula C28H30O6 and a molecular weight of 462.5 g/mol. IUPAC name: 5-[2,5-ditert-butyl-4-(3-carboxy-4-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid. InChIKey: PNMSXPCWQAYNBF-UHFFFAOYSA-N.
| Molecular formula | C28H30O6 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | 5-[2,5-ditert-butyl-4-(3-carboxy-4-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid |
| InChIKey | PNMSXPCWQAYNBF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1C2=CC(=C(C=C2)O)C(=O)O)C(C)(C)C)C3=CC(=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)