Products 197447-32-8
CAS 197447-32-8 appears in our catalog under these names: Latisxanthone C, Latisxanthone C. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, Get quote.
7,9,12-trihydroxy-2,2-dimethyl-8,10-bis(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one (CAS 197447-32-8) is a chemical compound with the molecular formula C28H30O6 and a molecular weight of 462.5 g/mol. IUPAC name: 7,9,12-trihydroxy-2,2-dimethyl-8,10-bis(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one. InChIKey: PZWBBMGLWODZNF-UHFFFAOYSA-N.
| Molecular formula | C28H30O6 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | 7,9,12-trihydroxy-2,2-dimethyl-8,10-bis(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one |
| InChIKey | PZWBBMGLWODZNF-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C3=C(O2)C(=C4C(=C3)C=CC(O4)(C)C)O)CC=C(C)C)O)C |
Computed by PubChem (NCBI)
Synonyms:
Latisxanthone C, orb1682227