Products 2444362-35-8
CAS 2444362-35-8 is the registry number for 2',5'-Diisobutoxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-carboxyphenyl)-2,5-bis(2-methylpropoxy)phenyl]benzoic acid (CAS 2444362-35-8) is a chemical compound with the molecular formula C28H30O6 and a molecular weight of 462.5 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,5-bis(2-methylpropoxy)phenyl]benzoic acid. InChIKey: LNIJMIUJXAACFO-UHFFFAOYSA-N.
| Molecular formula | C28H30O6 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,5-bis(2-methylpropoxy)phenyl]benzoic acid |
| InChIKey | LNIJMIUJXAACFO-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC(=C(C=C1C2=CC=C(C=C2)C(=O)O)OCC(C)C)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)