Products 91110-24-6
CAS 91110-24-6 is the registry number for 1-O-Acetyl-2,3,5-tri-O-benzyl-b-D-ribofuranose. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg.
[(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl] acetate (CAS 91110-24-6) is a chemical compound with the molecular formula C28H30O6 and a molecular weight of 462.5 g/mol. IUPAC name: [(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl] acetate. InChIKey: CPWPSDGLXXKBKZ-BIYDSLDMSA-N.
| Molecular formula | C28H30O6 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | [(2S,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl] acetate |
| InChIKey | CPWPSDGLXXKBKZ-BIYDSLDMSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@@H]([C@H](O1)COCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)