CAS 202277-51-8 is the registry number for 4-Amino-6-methyl-5-nitropyridazin-3(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-amino-3-methyl-4-nitro-1H-pyridazin-6-one (CAS 202277-51-8) is a chemical compound with the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. IUPAC name: 5-amino-3-methyl-4-nitro-1H-pyridazin-6-one. InChIKey: XGVDCQRICPNGEW-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O3 |
|---|---|
| Molecular weight | 170.13 g/mol |
| IUPAC name | 5-amino-3-methyl-4-nitro-1H-pyridazin-6-one |
| InChIKey | XGVDCQRICPNGEW-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=O)C(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)