CAS 92534-72-0 appears in our catalog under these names: 1-Methyl-4-nitro-1h-pyrazole-5-carboxamide, 95%, 1–Methyl–4–nitro–1H–pyrazole–5–carboxamide, 1-Methyl-4-nitro-1H-pyrazole-5-carboxamide, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
1-methyl-4-nitropyrazole-5-carboxamide (CAS 92534-72-0) is a chemical compound with the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. IUPAC name: 1-methyl-4-nitropyrazole-5-carboxamide. InChIKey: OZIJRCYSJKCNNZ-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O3 |
|---|---|
| Molecular weight | 170.13 g/mol |
| IUPAC name | 1-methyl-4-nitropyrazole-5-carboxamide |
| InChIKey | OZIJRCYSJKCNNZ-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)