CAS 60728-89-4 is the registry number for 1-(3-Nitro-1h-1,2,4-triazol-1-yl)acetone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-(3-nitro-1,2,4-triazol-1-yl)propan-2-one (CAS 60728-89-4) is a chemical compound with the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. IUPAC name: 1-(3-nitro-1,2,4-triazol-1-yl)propan-2-one. InChIKey: LSBLHAUYFVFQSJ-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O3 |
|---|---|
| Molecular weight | 170.13 g/mol |
| IUPAC name | 1-(3-nitro-1,2,4-triazol-1-yl)propan-2-one |
| InChIKey | LSBLHAUYFVFQSJ-UHFFFAOYSA-N |
| SMILES | CC(=O)CN1C=NC(=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)