Products 202325-50-6
CAS 202325-50-6 appears in our catalog under these names: o-Cresol-d7, >95% (HPLC), o-Cresol-d7, 98 atom % D, min 98% Chemical Purity, o-Cresol-d7. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 250mg, 25mg, 1g, 0,5g, 50mg, 100mg, 25 mg, 10 mg.
2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenol (CAS 202325-50-6) is a chemical compound with the molecular formula C7H8O and a molecular weight of 115.18 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenol. InChIKey: QWVGKYWNOKOFNN-AAYPNNLASA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 115.18 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(trideuteriomethyl)phenol |
| InChIKey | QWVGKYWNOKOFNN-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])O)[2H])[2H] |
Computed by PubChem (NCBI)