Products 70837-27-3
CAS 70837-27-3 appears in our catalog under these names: o-Cresol-d3 (methyl-d3), >95% (HPLC), o-Cresol-d3 (methyl-d3), 99 atom % D, min 98% Chemical Purity, o–Cresol–d3, 2-(Methyl-d3)phenol. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 10 mg, 50 mg, 5 mg.
2-(trideuteriomethyl)phenol (CAS 70837-27-3) is a chemical compound with the molecular formula C7H8O and a molecular weight of 111.16 g/mol. IUPAC name: 2-(trideuteriomethyl)phenol. InChIKey: QWVGKYWNOKOFNN-FIBGUPNXSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 111.16 g/mol |
| IUPAC name | 2-(trideuteriomethyl)phenol |
| InChIKey | QWVGKYWNOKOFNN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=CC=C1O |
Computed by PubChem (NCBI)