Products 3647-00-5
CAS 3647-00-5 is the registry number for o-Cresol-3,4,5,6-d4,OD, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,2,3,4-tetradeuterio-5-deuteriooxy-6-methylbenzene (CAS 3647-00-5) is a chemical compound with the molecular formula C7H8O and a molecular weight of 113.17 g/mol. IUPAC name: 1,2,3,4-tetradeuterio-5-deuteriooxy-6-methylbenzene. InChIKey: QWVGKYWNOKOFNN-MDXQMYCFSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 113.17 g/mol |
| IUPAC name | 1,2,3,4-tetradeuterio-5-deuteriooxy-6-methylbenzene |
| InChIKey | QWVGKYWNOKOFNN-MDXQMYCFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C)O[2H])[2H])[2H] |
Computed by PubChem (NCBI)