Products 202325-51-7
CAS 202325-51-7 appears in our catalog under these names: m-Cresol-d7, >95% (HPLC), m-Cresol-d7, 98 atom % D, min 98% Chemical Purity, m–Cresol–d7. Offered by: TRC, CDN, GLPBio. Available pack sizes: 10mg, 50mg, 0,5g, 0,25g.
2,3,4,6-tetradeuterio-5-(trideuteriomethyl)phenol (CAS 202325-51-7) is a chemical compound with the molecular formula C7H8O and a molecular weight of 115.18 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)phenol. InChIKey: RLSSMJSEOOYNOY-AAYPNNLASA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 115.18 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)phenol |
| InChIKey | RLSSMJSEOOYNOY-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])O)[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)