Products 25026-32-8
CAS 25026-32-8 appears in our catalog under these names: m-Cresol-d3 (methyl-d3), m-Cresol-d3 (methyl-d3), 98 atom % D, min 98% Chemical Purity, M–CRESOL–D3. Offered by: TRC, CDN, GLPBio. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g.
3-(trideuteriomethyl)phenol (CAS 25026-32-8) is a chemical compound with the molecular formula C7H8O and a molecular weight of 111.16 g/mol. IUPAC name: 3-(trideuteriomethyl)phenol. InChIKey: RLSSMJSEOOYNOY-FIBGUPNXSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 111.16 g/mol |
| IUPAC name | 3-(trideuteriomethyl)phenol |
| InChIKey | RLSSMJSEOOYNOY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)