Products 302911-90-6
CAS 302911-90-6 is the registry number for m-Cresol-d8, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,2,3,5-tetradeuterio-4-deuteriooxy-6-(trideuteriomethyl)benzene (CAS 302911-90-6) is a chemical compound with the molecular formula C7H8O and a molecular weight of 116.19 g/mol. IUPAC name: 1,2,3,5-tetradeuterio-4-deuteriooxy-6-(trideuteriomethyl)benzene. InChIKey: RLSSMJSEOOYNOY-IWRLGKISSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 116.19 g/mol |
| IUPAC name | 1,2,3,5-tetradeuterio-4-deuteriooxy-6-(trideuteriomethyl)benzene |
| InChIKey | RLSSMJSEOOYNOY-IWRLGKISSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])O[2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)