Products 202326-57-6
CAS 202326-57-6 appears in our catalog under these names: L-Methionine-13C5, L–Methionine–13C5, L-Methionine-13C5, 98.0%, 98.0%, L-Methionine-13C5, 99.4%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 10 mg, 1 mg, 5 mg, 25 mg.
(2S)-2-amino-4-(113C)methylsulfanyl(1,2,3,4-13C4)butanoic acid (CAS 202326-57-6) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 154.18 g/mol. IUPAC name: (2S)-2-amino-4-(113C)methylsulfanyl(1,2,3,4-13C4)butanoic acid. InChIKey: FFEARJCKVFRZRR-JRGPAWSWSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 154.18 g/mol |
| IUPAC name | (2S)-2-amino-4-(113C)methylsulfanyl(1,2,3,4-13C4)butanoic acid |
| InChIKey | FFEARJCKVFRZRR-JRGPAWSWSA-N |
| SMILES | [13CH3]S[13CH2][13CH2][13C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)