Products 67866-75-5
CAS 67866-75-5 appears in our catalog under these names: L–Methionine–d4, L-Methionine-3,3,4,4-d4, >95% (HPLC), L-Methionine-3,3,4,4-d4, 98 atom % D, min 98% Chemical Purity, L-Methionine-d4, 99.91%. Offered by: GLPBio, TRC, CDN, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 2mg, 0,1g, 0,05g, 10 mg, 1 mg.
(2S)-2,3-dideuterio-2-(dideuterioamino)-4-methylsulfanylbutanoic acid (CAS 67866-75-5) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 153.24 g/mol. IUPAC name: (2S)-2,3-dideuterio-2-(dideuterioamino)-4-methylsulfanylbutanoic acid. InChIKey: FFEARJCKVFRZRR-WDNFZIOJSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 153.24 g/mol |
| IUPAC name | (2S)-2,3-dideuterio-2-(dideuterioamino)-4-methylsulfanylbutanoic acid |
| InChIKey | FFEARJCKVFRZRR-WDNFZIOJSA-N |
| SMILES | [2H]C(CSC)[C@@]([2H])(C(=O)O)N([2H])[2H] |
Computed by PubChem (NCBI)