Products 93709-61-6
CAS 93709-61-6 appears in our catalog under these names: DL-Methionine-3,3,4,4-d4, (±)-Methionine-d4, >95% (HPLC), DL-Methionine-3,3,4,4-d4, 99 atom % D, min 98% Chemical Purity, DL–Methionine–d4, (±)-Methionine-d4. Offered by: Chemat Brand, TRC, CDN, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 0,25g, 0,1g, 5mg, 50mg, 5 mg.
2-amino-3,3,4,4-tetradeuterio-4-methylsulfanylbutanoic acid (CAS 93709-61-6) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 153.24 g/mol. IUPAC name: 2-amino-3,3,4,4-tetradeuterio-4-methylsulfanylbutanoic acid. InChIKey: FFEARJCKVFRZRR-RRVWJQJTSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 153.24 g/mol |
| IUPAC name | 2-amino-3,3,4,4-tetradeuterio-4-methylsulfanylbutanoic acid |
| InChIKey | FFEARJCKVFRZRR-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(C(C(=O)O)N)C([2H])([2H])SC |
Computed by PubChem (NCBI)