Products 202406-52-8
CAS 202406-52-8 appears in our catalog under these names: L–Leucine–13C6,15N, L-Leucine-13C6，15N, L-Leucine-13C6,15N, 99.90%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 100mg, 5 mg, 1 mg, 10 mg.
(2S)-2-(15N)azanyl-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid (CAS 202406-52-8) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 138.12 g/mol. IUPAC name: (2S)-2-(15N)azanyl-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid. InChIKey: ROHFNLRQFUQHCH-HUEJSTCGSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | ROHFNLRQFUQHCH-HUEJSTCGSA-N |
| SMILES | [13CH3][13CH]([13CH3])[13CH2][13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)
Synonyms:
L-Leucine-13C6,15N, L-Leucine-13C615N, (2S)-2-(15N)azanyl-4-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid, orb3138690, L-Isoleucine-13C6,15N, 98 atom % 13C, 98 atom % 15N, 95% (CP), L-Leucine-13C6,15N, 98 atom % 13C, 98 atom % 15N, 95% (CP), L-Leucine-13C6,15N, 98 atom % 15N, 98 atom % 13C, 99% chiral purity basis