Products 202406-87-9
CAS 202406-87-9 appears in our catalog under these names: L-Asparagine-13C4, 15N2 Hydrate, >95% (HPLC), L–Asparagine–13C4,15N2 monohydrate, L-Asparagine-13C4,15N2 (monohydrate), 98%, 98%, L-Asparagine-13C4,15N2 (monohydrate), 98.0%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 0,25mg, 0,5mg, 2,5mg, 1mg, 10mg, 5mg, 10 mg, 5 mg.
(2S)-2,4-bis(15N)(azanyl)-4-oxo(1,2,3,4-13C4)butanoic acid;hydrate (CAS 202406-87-9) is a chemical compound with the molecular formula C4H10N2O4 and a molecular weight of 156.09 g/mol. IUPAC name: (2S)-2,4-bis(15N)(azanyl)-4-oxo(1,2,3,4-13C4)butanoic acid;hydrate. InChIKey: RBMGJIZCEWRQES-KNBQNQHASA-N.
| Molecular formula | C4H10N2O4 |
|---|---|
| Molecular weight | 156.09 g/mol |
| IUPAC name | (2S)-2,4-bis(15N)(azanyl)-4-oxo(1,2,3,4-13C4)butanoic acid;hydrate |
| InChIKey | RBMGJIZCEWRQES-KNBQNQHASA-N |
| SMILES | [13CH2]([13C@@H]([13C](=O)O)[15NH2])[13C](=O)[15NH2].O |
Computed by PubChem (NCBI)