CAS 204451-47-8 appears in our catalog under these names: L-Asparagine-amide-15N monohydrate, 98% +98%atom%15N, L–Asparagine–amide–15N monohydrate, L-Asparagine-amide-15N (monohydrate), 99.80%, L-Asparagine-(amide-15N) monohydrate 15N, L-Asparagine-amide-15N (monohydrate), ≥98 atom% 15N,≥98.5%. Offered by: AmBeed, GLPBio, MedChemExpress, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 10mg, 25mg, 5mg, 10 mg, 5 mg, 25 mg.
(2S)-2-amino-4-(15N)azanyl-4-oxobutanoic acid;hydrate (CAS 204451-47-8) is a chemical compound with the molecular formula C4H10N2O4 and a molecular weight of 151.13 g/mol. IUPAC name: (2S)-2-amino-4-(15N)azanyl-4-oxobutanoic acid;hydrate. InChIKey: RBMGJIZCEWRQES-UEFLAVRISA-N.
| Molecular formula | C4H10N2O4 |
|---|---|
| Molecular weight | 151.13 g/mol |
| IUPAC name | (2S)-2-amino-4-(15N)azanyl-4-oxobutanoic acid;hydrate |
| InChIKey | RBMGJIZCEWRQES-UEFLAVRISA-N |
| SMILES | C([C@@H](C(=O)O)N)C(=O)[15NH2].O |
Computed by PubChem (NCBI)