Products 2483831-59-8
CAS 2483831-59-8 appears in our catalog under these names: L-Asparagine-d3 Hydrate, >95% (HPLC), L-Asparagine-2,3,3,-d3 H2O, 98 atom % D, min 98% Chemical Purity, L–Asparagine–d3 (hydrate), L-Asparagine-d3 (hydrate), 99.64%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,01g, 1mg, 5mg, 5 mg, 1 mg.
(2S)-2,4-diamino-2,3,3-trideuterio-4-oxobutanoic acid;hydrate (CAS 2483831-59-8) is a chemical compound with the molecular formula C4H10N2O4 and a molecular weight of 153.15 g/mol. IUPAC name: (2S)-2,4-diamino-2,3,3-trideuterio-4-oxobutanoic acid;hydrate. InChIKey: RBMGJIZCEWRQES-HWSDRXMZSA-N.
| Molecular formula | C4H10N2O4 |
|---|---|
| Molecular weight | 153.15 g/mol |
| IUPAC name | (2S)-2,4-diamino-2,3,3-trideuterio-4-oxobutanoic acid;hydrate |
| InChIKey | RBMGJIZCEWRQES-HWSDRXMZSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C(=O)N)N.O |
Computed by PubChem (NCBI)