Products 202407-23-6
CAS 202407-23-6 appears in our catalog under these names: L-Proline-13C5,15N, 99%, 99%, L-Proline-13C5,15N, 99.60%. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 5 mg, 1 mg, 10 mg, 25 mg.
(2S)-(2,3,4,5-13C4,115N)azolidine-2-carboxylic acid (CAS 202407-23-6) is a chemical compound with the molecular formula C5H9NO2 and a molecular weight of 121.087 g/mol. IUPAC name: (2S)-(2,3,4,5-13C4,115N)azolidine-2-carboxylic acid. InChIKey: ONIBWKKTOPOVIA-XAFSXMPTSA-N.
| Molecular formula | C5H9NO2 |
|---|---|
| Molecular weight | 121.087 g/mol |
| IUPAC name | (2S)-(2,3,4,5-13C4,115N)azolidine-2-carboxylic acid |
| InChIKey | ONIBWKKTOPOVIA-XAFSXMPTSA-N |
| SMILES | [13CH2]1[13CH2][13C@H]([15NH][13CH2]1)[13C](=O)O |
Computed by PubChem (NCBI)