Products 202407-30-5
CAS 202407-30-5 appears in our catalog under these names: L–Valine–13C5,15N, L-Valine-13C5,15N, >95% (HPLC), L-VALINE-13C5,15N, 98 ATOM% 13C, 98 ATO&, L-Valine-13C5,15N, 98 atom % 13C, 98 atom % 15N, 95%(CP), 98 atom % 13C, 98 atom % 15N, 95%(CP), L-Valine-13C5,15N, 99.64%. Offered by: GLPBio, TRC, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 5mg, 50mg, 1mg, 10mg, 1G, 250MG, 25mg, 25 mg.
(2S)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4-13C4)butanoic acid (CAS 202407-30-5) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 123.103 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4-13C4)butanoic acid. InChIKey: KZSNJWFQEVHDMF-XAFSXMPTSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 123.103 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4-13C4)butanoic acid |
| InChIKey | KZSNJWFQEVHDMF-XAFSXMPTSA-N |
| SMILES | [13CH3][13CH]([13CH3])[13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)
Synonyms:
L-Valine-13C5,15N, Carbonomic, Carbon C 13/Nitrogen N 15-labeled Valine, C13 N15 Valine, L-2-Amino-3-methylbutanoic Acid-13C5,15N, (+)-2-Amino-3-methylbutyric Acid-13C5,15N, L-Valine-13C5,1?N, ((13)C5,(15)N)-valine, (2S)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4-13C4)butanoic acid, (2R)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4-13C4)butanoic acid