Products 2024430-38-2

CAS 2024430-38-2 is the registry number for 4,4-Difluoro-3,3-dimethylpentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4,4-difluoro-3,3-dimethylpentanoic acid (CAS 2024430-38-2) is a chemical compound with the molecular formula C7H12F2O2 and a molecular weight of 166.17 g/mol. IUPAC name: 4,4-difluoro-3,3-dimethylpentanoic acid. InChIKey: HTPZWHAWGVLSCG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12F2O2
Molecular weight166.17 g/mol
IUPAC name4,4-difluoro-3,3-dimethylpentanoic acid
InChIKeyHTPZWHAWGVLSCG-UHFFFAOYSA-N
SMILESCC(C)(CC(=O)O)C(C)(F)F

Computed by PubChem (NCBI)