CAS 2924907-28-6 is the registry number for rel-(1R,3S)-4,4-Difluoro-3-methoxycyclohexan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,3S)-4,4-difluoro-3-methoxycyclohexan-1-ol (CAS 2924907-28-6) is a chemical compound with the molecular formula C7H12F2O2 and a molecular weight of 166.17 g/mol. IUPAC name: cis-(1R,3S)-4,4-difluoro-3-methoxycyclohexan-1-ol. InChIKey: YZGZIQWGQVZWIM-RITPCOANSA-N.
| Molecular formula | C7H12F2O2 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | cis-(1R,3S)-4,4-difluoro-3-methoxycyclohexan-1-ol |
| InChIKey | YZGZIQWGQVZWIM-RITPCOANSA-N |
| SMILES | CO[C@H]1C[C@@H](CCC1(F)F)O |
Computed by PubChem (NCBI)