CAS 84409-70-1 is the registry number for (4S,5S)-(+)-4,5-Bis(fluoromethyl)-2,2-dimethyl-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4S,5S)-4,5-bis(fluoromethyl)-2,2-dimethyl-1,3-dioxolane (CAS 84409-70-1) is a chemical compound with the molecular formula C7H12F2O2 and a molecular weight of 166.17 g/mol. IUPAC name: (4S,5S)-4,5-bis(fluoromethyl)-2,2-dimethyl-1,3-dioxolane. InChIKey: LFHJRQWZIPGXAM-PHDIDXHHSA-N.
| Molecular formula | C7H12F2O2 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | (4S,5S)-4,5-bis(fluoromethyl)-2,2-dimethyl-1,3-dioxolane |
| InChIKey | LFHJRQWZIPGXAM-PHDIDXHHSA-N |
| SMILES | CC1(O[C@@H]([C@H](O1)CF)CF)C |
Computed by PubChem (NCBI)