CAS 202464-88-8 is the registry number for (S)-Rasagiline Mesylate. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
Methanesulfonic acid;(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (CAS 202464-88-8) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. IUPAC name: methanesulfonic acid;(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine. InChIKey: JDBJJCWRXSVHOQ-YDALLXLXSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 267.35 g/mol |
| IUPAC name | methanesulfonic acid;(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | JDBJJCWRXSVHOQ-YDALLXLXSA-N |
| SMILES | CS(=O)(=O)O.C#CCN[C@H]1CCC2=CC=CC=C12 |
Computed by PubChem (NCBI)