CAS 161735-79-1 appears in our catalog under these names: Rasagiline Mesylate, Rasagiline Mesilate, Rasagiline Mesylate, >95% (HPLC), Rasagiline Mesylate, Rasagiline Mesylate/ 100%. Offered by: Chemat Brand, Mikromol, TRC, GLPBio, TargetMol. Available pack sizes: on request, 250mg, 100mg, 500mg, 10mM (in 1ml dmso), 50mg, 1g, 5g.
Methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (CAS 161735-79-1) is a chemical compound with the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. IUPAC name: methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine. InChIKey: JDBJJCWRXSVHOQ-UTONKHPSSA-N.
| Molecular formula | C13H17NO3S |
|---|---|
| Molecular weight | 267.35 g/mol |
| IUPAC name | methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | JDBJJCWRXSVHOQ-UTONKHPSSA-N |
| SMILES | CS(=O)(=O)O.C#CCN[C@@H]1CCC2=CC=CC=C12 |
Computed by PubChem (NCBI)