CAS 202584-20-1 is the registry number for Methyl 6-(methylsulfanyl)-1H-indole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 6-methylsulfanyl-1H-indole-2-carboxylate (CAS 202584-20-1) is a chemical compound with the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. IUPAC name: methyl 6-methylsulfanyl-1H-indole-2-carboxylate. InChIKey: WIDPUEXDDQAFTO-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | methyl 6-methylsulfanyl-1H-indole-2-carboxylate |
| InChIKey | WIDPUEXDDQAFTO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C=C(C=C2)SC |
Computed by PubChem (NCBI)