Products 20267-89-4
CAS 20267-89-4 is the registry number for Isogermafurenolide. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
(5S,6S,7aS)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-4,5,7,7a-tetrahydro-1-benzofuran-2-one (CAS 20267-89-4) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: (5S,6S,7aS)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-4,5,7,7a-tetrahydro-1-benzofuran-2-one. InChIKey: IEOHWPUTLCTSCQ-KCQAQPDRSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (5S,6S,7aS)-6-ethenyl-3,6-dimethyl-5-prop-1-en-2-yl-4,5,7,7a-tetrahydro-1-benzofuran-2-one |
| InChIKey | IEOHWPUTLCTSCQ-KCQAQPDRSA-N |
| SMILES | CC1=C2C[C@H]([C@](C[C@@H]2OC1=O)(C)C=C)C(=C)C |
Computed by PubChem (NCBI)