Products 2030-53-7
CAS 2030-53-7 is the registry number for Aporeine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, Get quote.
(12S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene (CAS 2030-53-7) is a chemical compound with the molecular formula C18H17NO2 and a molecular weight of 279.3 g/mol. IUPAC name: (12S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene. InChIKey: JCTYWRARKVGOBK-AWEZNQCLSA-N.
| Molecular formula | C18H17NO2 |
|---|---|
| Molecular weight | 279.3 g/mol |
| IUPAC name | (12S)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene |
| InChIKey | JCTYWRARKVGOBK-AWEZNQCLSA-N |
| SMILES | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC=CC=C54)OCO3 |
Computed by PubChem (NCBI)