Products 2030182-29-5
CAS 2030182-29-5 is the registry number for Fluometuron-d6. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
1,1-bis(trideuteriomethyl)-3-[3-(trifluoromethyl)phenyl]urea (CAS 2030182-29-5) is a chemical compound with the molecular formula C10H11F3N2O and a molecular weight of 238.24 g/mol. IUPAC name: 1,1-bis(trideuteriomethyl)-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: RZILCCPWPBTYDO-WFGJKAKNSA-N.
| Molecular formula | C10H11F3N2O |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1,1-bis(trideuteriomethyl)-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | RZILCCPWPBTYDO-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C(=O)NC1=CC=CC(=C1)C(F)(F)F)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)