CAS 20308-97-8 is the registry number for 3-(9-Anthracenyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-anthracen-9-ylpyridine (CAS 20308-97-8) is a chemical compound with the molecular formula C19H13N and a molecular weight of 255.3 g/mol. IUPAC name: 3-anthracen-9-ylpyridine. InChIKey: XVELJKVGYZEBLI-UHFFFAOYSA-N.
| Molecular formula | C19H13N |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 3-anthracen-9-ylpyridine |
| InChIKey | XVELJKVGYZEBLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C4=CN=CC=C4 |
Computed by PubChem (NCBI)