CAS 2720-93-6 is the registry number for 6-Phenyl-phenanthridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
6-phenylphenanthridine (CAS 2720-93-6) is a chemical compound with the molecular formula C19H13N and a molecular weight of 255.3 g/mol. IUPAC name: 6-phenylphenanthridine. InChIKey: XXWONCALJGBUFK-UHFFFAOYSA-N.
| Molecular formula | C19H13N |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 6-phenylphenanthridine |
| InChIKey | XXWONCALJGBUFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)