CAS 2031259-37-5 is the registry number for 3-((2-Chloroacetamido)methyl)-N,N-dimethylbenzamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[[(2-chloroacetyl)amino]methyl]-N,N-dimethylbenzamide (CAS 2031259-37-5) is a chemical compound with the molecular formula C12H15ClN2O2 and a molecular weight of 254.71 g/mol. IUPAC name: 3-[[(2-chloroacetyl)amino]methyl]-N,N-dimethylbenzamide. InChIKey: KDJGVAWPRAMUMM-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 3-[[(2-chloroacetyl)amino]methyl]-N,N-dimethylbenzamide |
| InChIKey | KDJGVAWPRAMUMM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=C1)CNC(=O)CCl |
Computed by PubChem (NCBI)