CAS 2031259-79-5 appears in our catalog under these names: 2-tert-butyl 4-methyl 2-azabicyclo(2.2.2)octane-2,4-dicarboxylate, 97%, 2-tert-butyl 4-methyl 2-azabicyclo[2.2.2]octane-2,4-dicarboxylate, 95%, 95%, 2-tert-Butyl 4-methyl 2-azabicyclo[2.2.2]octane-2,4-dicarboxylate, 97%, 2-tert-Butyl 4-methyl 2-azabicyclo[2.2.2]octane-2,4-dicarboxylate, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g.
2-O-tert-butyl 4-O-methyl 2-azabicyclo[2.2.2]octane-2,4-dicarboxylate (CAS 2031259-79-5) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 2-O-tert-butyl 4-O-methyl 2-azabicyclo[2.2.2]octane-2,4-dicarboxylate. InChIKey: RBUHRXSCCDWPPV-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 2-O-tert-butyl 4-O-methyl 2-azabicyclo[2.2.2]octane-2,4-dicarboxylate |
| InChIKey | RBUHRXSCCDWPPV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCC1CC2)C(=O)OC |
Computed by PubChem (NCBI)