Products 20324-50-9

CAS 20324-50-9 is the registry number for 5-Chloro-2-sulfanylbenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

5-chloro-2-sulfanylbenzoic acid (CAS 20324-50-9) is a chemical compound with the molecular formula C7H5ClO2S and a molecular weight of 188.63 g/mol. IUPAC name: 5-chloro-2-sulfanylbenzoic acid. InChIKey: BRJPZCDOLGSYPS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClO2S
Molecular weight188.63 g/mol
IUPAC name5-chloro-2-sulfanylbenzoic acid
InChIKeyBRJPZCDOLGSYPS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C(=O)O)S

Computed by PubChem (NCBI)