Products 20324-51-0
CAS 20324-51-0 is the registry number for 2-Chloro-6-mercaptobenzoic acid, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
2-chloro-6-sulfanylbenzoic acid (CAS 20324-51-0) is a chemical compound with the molecular formula C7H5ClO2S and a molecular weight of 188.63 g/mol. IUPAC name: 2-chloro-6-sulfanylbenzoic acid. InChIKey: AQKPOJRMYFQSLX-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO2S |
|---|---|
| Molecular weight | 188.63 g/mol |
| IUPAC name | 2-chloro-6-sulfanylbenzoic acid |
| InChIKey | AQKPOJRMYFQSLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)S |
Computed by PubChem (NCBI)