Products 41914-51-6
CAS 41914-51-6 is the registry number for (E)-3-(5-Chlorothiophen-2-yl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
(E)-3-(5-chlorothiophen-2-yl)prop-2-enoic acid (CAS 41914-51-6) is a chemical compound with the molecular formula C7H5ClO2S and a molecular weight of 188.63 g/mol. IUPAC name: (E)-3-(5-chlorothiophen-2-yl)prop-2-enoic acid. InChIKey: JAFVPRMULXJDEN-DUXPYHPUSA-N.
| Molecular formula | C7H5ClO2S |
|---|---|
| Molecular weight | 188.63 g/mol |
| IUPAC name | (E)-3-(5-chlorothiophen-2-yl)prop-2-enoic acid |
| InChIKey | JAFVPRMULXJDEN-DUXPYHPUSA-N |
| SMILES | C1=C(SC(=C1)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-chlorothiophen-2-yl)-propenoic acid, (2E)-3-(5-chlorothiophen-2-yl)prop-2-enoic acid, (E)-3-(5-chlorothiophen-2-yl)prop-2-enoic acid, (2E)-3-(5-chlorothien-2-yl)acrylic acid, 2-Propenoic acid, 3-(5-chloro-2-thienyl)-, 3-(5-chlorothiophen-2-yl)acrylic acid, JAFVPRMULXJDEN-DUXPYHPUSA-N, 3-(5-Chloro-thiophen-2-yl)-(E)-acrylic acid, (E)-3-(5-Chlorothiophen-2-yl)acrylic acid - [C90441]