CAS 2033-42-3 appears in our catalog under these names: 1–IODO–2–NAPHTHOL, 1-Iodo-2-naphthol 97%, 1-Iodo-2-naphthol, 98%, 98%, 1-Iodo-2-naphthol, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g, 100mg.
1-iodonaphthalen-2-ol (CAS 2033-42-3) is a chemical compound with the molecular formula C10H7IO and a molecular weight of 270.07 g/mol. IUPAC name: 1-iodonaphthalen-2-ol. InChIKey: JEVGGOSILOIIHN-UHFFFAOYSA-N.
| Molecular formula | C10H7IO |
|---|---|
| Molecular weight | 270.07 g/mol |
| IUPAC name | 1-iodonaphthalen-2-ol |
| InChIKey | JEVGGOSILOIIHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2I)O |
Computed by PubChem (NCBI)